C35H44O9 — CID 11786806
tert-butyl 2-[(2S,9S,12R,13R,15S)-15-[(E)-hex-4-enoyl]-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate (PubChem CID 11786806) has the molecular formula C35H44O9 and a molecular weight of 608.73 g/mol. Its IUPAC name is tert-butyl 2-[(2S,9S,12R,13R,15S)-15-[(E)-hex-4-enoyl]-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,9S,12R,13R,15S)-15-[(E)-hex-4-enoyl]-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate |
|---|---|
| PubChem CID | 11786806 |
| Molecular Formula | C35H44O9 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | tert-butyl 2-[(2S,9S,12R,13R,15S)-15-[(E)-hex-4-enoyl]-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate |
| SMILES | C/C=C/CCCCC[C@H]1C=C2C34OC(=O)[C@]2(CC(=O)OC(C)(C)C)CC2=C(C(=O)OC2=O)[C@@H]3[C@@H]1C[C@@H](C(=O)CC/C=C/C)O4 |
| InChI | InChI=1S/C35H44O9/c1-6-8-10-11-12-14-15-21-17-26-34(20-27(37)43-33(3,4)5)19-23-28(31(39)41-30(23)38)29-22(21)18-25(24(36)16-13-9-7-2)42-35(26,29)44-32(34)40/h6-9,17,21-22,25,29H,10-16,18-20H2,1-5H3/b8-6+,9-7+/t21-,22+,25-,29-,34-,35?/m0/s1 |
| InChIKey | LQPXBXSBXVMIAP-ITZMXSPRSA-N |
| XLogP | 5.77 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|