C33H42NO8P — CID 11786834
[(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphite (PubChem CID 11786834) has the molecular formula C33H42NO8P and a molecular weight of 611.67 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphite.
| Compound Name | [(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphite |
|---|---|
| PubChem CID | 11786834 |
| Molecular Formula | C33H42NO8P |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphite |
| SMILES | CCOP(OCC)O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C33H42NO8P/c1-4-39-43(40-5-2)42-33-30(34-25(3)35)32(38-23-28-19-13-8-14-20-28)31(37-22-27-17-11-7-12-18-27)29(41-33)24-36-21-26-15-9-6-10-16-26/h6-20,29-33H,4-5,21-24H2,1-3H3,(H,34,35)/t29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | CUUJACAHVHJJIZ-YKNMHBIISA-N |
| XLogP | 5.92 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|