C29H20Cl2N6O6 — CID 11786884
4,14-bis[(2-chlorophenyl)methyl]-9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone (PubChem CID 11786884) has the molecular formula C29H20Cl2N6O6 and a molecular weight of 619.42 g/mol. Its IUPAC name is 4,14-bis[(2-chlorophenyl)methyl]-9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone.
| Compound Name | 4,14-bis[(2-chlorophenyl)methyl]-9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone |
|---|---|
| PubChem CID | 11786884 |
| Molecular Formula | C29H20Cl2N6O6 |
| Molecular Weight | 619.42 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | 4,14-bis[(2-chlorophenyl)methyl]-9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2Cl)c2c1C(c1ccc([N+](=O)[O-])cc1)c1c(n(Cc3ccccc3Cl)c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C29H20Cl2N6O6/c30-19-7-3-1-5-16(19)13-35-24-22(26(38)33-28(35)40)21(15-9-11-18(12-10-15)37(42)43)23-25(32-24)36(29(41)34-27(23)39)14-17-6-2-4-8-20(17)31/h1-12,21,32H,13-14H2,(H,33,38,40)(H,34,39,41) |
| InChIKey | MBYWLBZRKPWBLZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|