C27H30ErN4O3 — CID 11786905
(6Z)-6-[[2-[bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;erbium (PubChem CID 11786905) has the molecular formula C27H30ErN4O3 and a molecular weight of 625.82 g/mol. Its IUPAC name is (6Z)-6-[[2-[bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;erbium.
| Compound Name | (6Z)-6-[[2-[bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;erbium |
|---|---|
| PubChem CID | 11786905 |
| Molecular Formula | C27H30ErN4O3 |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | (6Z)-6-[[2-[bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;erbium |
| SMILES | O=C1C=CC=C/C1=C/NCCN(CCN/C=C1/C=CC=CC1=O)CCN/C=C1/C=CC=CC1=O.[Er] |
| InChI | InChI=1S/C27H30N4O3.Er/c32-25-10-4-1-7-22(25)19-28-13-16-31(17-14-29-20-23-8-2-5-11-26(23)33)18-15-30-21-24-9-3-6-12-27(24)34;/h1-12,19-21,28-30H,13-18H2;/b22-19-,23-20-,24-21-; |
| InChIKey | FHFLRDCDCYJFHI-OGCOIZSQSA-N |
| XLogP | 1.79 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|