C13H5Br5O4 — CID 11786911
2-bromo-6-(2,3,4,5-tetrabromo-6-methoxyphenoxy)cyclohexa-2,5-diene-1,4-dione (PubChem CID 11786911) has the molecular formula C13H5Br5O4 and a molecular weight of 624.70 g/mol. Its IUPAC name is 2-bromo-6-(2,3,4,5-tetrabromo-6-methoxyphenoxy)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-6-(2,3,4,5-tetrabromo-6-methoxyphenoxy)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11786911 |
| Molecular Formula | C13H5Br5O4 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 619.61 |
| IUPAC Name | 2-bromo-6-(2,3,4,5-tetrabromo-6-methoxyphenoxy)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1c(Br)c(Br)c(Br)c(Br)c1OC1=CC(=O)C=C(Br)C1=O |
| InChI | InChI=1S/C13H5Br5O4/c1-21-12-9(17)7(15)8(16)10(18)13(12)22-6-3-4(19)2-5(14)11(6)20/h2-3H,1H3 |
| InChIKey | APYDGRSKTTVHDG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|