C35H64O7Si — CID 11786915
methyl 2-[(2S,3S,4S,6R)-6-[(4R)-5-[(4R,6R)-6-ethenyl-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methyl-2-methylidenepentyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 11786915) has the molecular formula C35H64O7Si and a molecular weight of 624.98 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4S,6R)-6-[(4R)-5-[(4R,6R)-6-ethenyl-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methyl-2-methylidenepentyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4S,6R)-6-[(4R)-5-[(4R,6R)-6-ethenyl-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methyl-2-methylidenepentyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 11786915 |
| Molecular Formula | C35H64O7Si |
| Molecular Weight | 624.98 g/mol |
| Exact Mass | 624.44 |
| IUPAC Name | methyl 2-[(2S,3S,4S,6R)-6-[(4R)-5-[(4R,6R)-6-ethenyl-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methyl-2-methylidenepentyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H](C[C@@H](C)C(O)C(=C)C[C@@H]2C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@H](CC(=O)OC)O2)C1(C)C |
| InChI | InChI=1S/C35H64O7Si/c1-16-30-34(11,12)31(41-35(13,14)40-30)18-25(9)33(37)24(8)17-27-19-29(26(10)28(39-27)20-32(36)38-15)42-43(21(2)3,22(4)5)23(6)7/h16,21-23,25-31,33,37H,1,8,17-20H2,2-7,9-15H3/t25-,26+,27-,28+,29+,30-,31-,33?/m1/s1 |
| InChIKey | MIQSSDAFTIINSD-OJIOEHAQSA-N |
| XLogP | 7.97 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.98 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|