About CID 11786959
CID 11786959 (PubChem CID 11786959) has the molecular formula C23H30BiCl2N2O
and a molecular weight of 630.39 g/mol.
Molecular Properties
| Compound Name | CID 11786959 |
| PubChem CID | 11786959 |
| Molecular Formula | C23H30BiCl2N2O |
| Molecular Weight | 630.39 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | — |
| SMILES | C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C9H16N2.C7H7O.C7H7.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-8-7-5-3-2-4-6-7;1-7-5-3-2-4-6-7;;;/h1-8H2;3-6H,1H3;3-6H,1H3;;2*1H/q;;;+2;;/p-2 |
| InChIKey | KETCOSFAEJPLRC-UHFFFAOYSA-L |
| XLogP | 4.70 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 630.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 11786959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11786959?
The IUPAC name of CID 11786959 (CID 11786959) is not available.
What is the SMILES notation for CID 11786959?
The canonical SMILES for CID 11786959 is C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccc(C)cc2)cc1.
What is the InChIKey of CID 11786959?
The InChIKey is KETCOSFAEJPLRC-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H16N2.C7H7O.C7H7.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-8-7-5-3-2-4-6-7;1-7-5-3-2-4-6-7;;;/h1-8H2;3-6H,1H3;3-6H,1H3;;2*1H/q;;;+2;;/p-2.
What are the key properties of CID 11786959?
CID 11786959 has a molecular weight of 630.39 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11786959 is sourced from PubChem (CID 11786959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).