C25H38F3IO9S — CID 11787331
3,3-dimethylbut-1-ynyl(phenyl)iodanium;1,4,7,10,13,16-hexaoxacyclooctadecane;trifluoromethanesulfonate (PubChem CID 11787331) has the molecular formula C25H38F3IO9S and a molecular weight of 698.53 g/mol. Its IUPAC name is 3,3-dimethylbut-1-ynyl(phenyl)iodanium;1,4,7,10,13,16-hexaoxacyclooctadecane;trifluoromethanesulfonate.
| Compound Name | 3,3-dimethylbut-1-ynyl(phenyl)iodanium;1,4,7,10,13,16-hexaoxacyclooctadecane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11787331 |
| Molecular Formula | C25H38F3IO9S |
| Molecular Weight | 698.53 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | 3,3-dimethylbut-1-ynyl(phenyl)iodanium;1,4,7,10,13,16-hexaoxacyclooctadecane;trifluoromethanesulfonate |
| SMILES | C1COCCOCCOCCOCCOCCO1.CC(C)(C)C#C[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H14I.C12H24O6.CHF3O3S/c1-12(2,3)9-10-13-11-7-5-4-6-8-11;1-2-14-5-6-16-9-10-18-12-11-17-8-7-15-4-3-13-1;2-1(3,4)8(5,6)7/h4-8H,1-3H3;1-12H2;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | NTQCZMZZIAODLP-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.53 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|