C31H67IO3Si3 — CID 11787336
[(1R,2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(Z)-4-iodobut-2-en-2-yl]-2-methylpentoxy]-tri(propan-2-yl)silane (PubChem CID 11787336) has the molecular formula C31H67IO3Si3 and a molecular weight of 699.04 g/mol. Its IUPAC name is [(1R,2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(Z)-4-iodobut-2-en-2-yl]-2-methylpentoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1R,2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(Z)-4-iodobut-2-en-2-yl]-2-methylpentoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11787336 |
| Molecular Formula | C31H67IO3Si3 |
| Molecular Weight | 699.04 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | [(1R,2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(Z)-4-iodobut-2-en-2-yl]-2-methylpentoxy]-tri(propan-2-yl)silane |
| SMILES | C/C(=C/CI)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H67IO3Si3/c1-23(2)38(24(3)4,25(5)6)35-29(26(7)19-21-32)27(8)28(34-37(17,18)31(12,13)14)20-22-33-36(15,16)30(9,10)11/h19,23-25,27-29H,20-22H2,1-18H3/b26-19-/t27-,28-,29-/m0/s1 |
| InChIKey | FMSMPLIZXUSCIB-OAIIPFFZSA-N |
| XLogP | 11.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.04 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|