C33H69IO4Si3 — CID 11787507
[(2R,3R,4R)-6-iodo-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 11787507) has the molecular formula C33H69IO4Si3 and a molecular weight of 741.07 g/mol. Its IUPAC name is [(2R,3R,4R)-6-iodo-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R,4R)-6-iodo-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11787507 |
| Molecular Formula | C33H69IO4Si3 |
| Molecular Weight | 741.07 g/mol |
| Exact Mass | 740.35 |
| IUPAC Name | [(2R,3R,4R)-6-iodo-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H]1OC(I)=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H69IO4Si3/c1-21(2)39(22(3)4,23(5)6)35-20-31-33(38-41(27(13)14,28(15)16)29(17)18)30(19-32(34)36-31)37-40(24(7)8,25(9)10)26(11)12/h19,21-31,33H,20H2,1-18H3/t30-,31-,33+/m1/s1 |
| InChIKey | JUGLXCNRWMCIPT-IZWPZILSSA-N |
| XLogP | 11.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.07 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|