C26H26P2 — CID 11787670
[(1S,2R,4S,7S)-5,6-dimethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane (PubChem CID 11787670) has the molecular formula C26H26P2 and a molecular weight of 400.44 g/mol. Its IUPAC name is [(1S,2R,4S,7S)-5,6-dimethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane.
| Compound Name | [(1S,2R,4S,7S)-5,6-dimethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 11787670 |
| Molecular Formula | C26H26P2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [(1S,2R,4S,7S)-5,6-dimethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane |
| SMILES | CC1=C(C)[C@H]2[C@H](P(c3ccccc3)c3ccccc3)C[C@@H]1[P@]2c1ccccc1 |
| InChI | InChI=1S/C26H26P2/c1-19-20(2)26-25(18-24(19)28(26)23-16-10-5-11-17-23)27(21-12-6-3-7-13-21)22-14-8-4-9-15-22/h3-17,24-26H,18H2,1-2H3/t24-,25+,26-,28-/m0/s1 |
| InChIKey | SHDHINXTGBQSJY-RVUATISTSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|