C9H8N2O2 — CID 11788
1-methylquinazoline-2,4-dione (PubChem CID 11788) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 1-methylquinazoline-2,4-dione.
| Compound Name | 1-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 11788 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1-methylquinazoline-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C9H8N2O2/c1-11-7-5-3-2-4-6(7)8(12)10-9(11)13/h2-5H,1H3,(H,10,12,13) |
| InChIKey | RWFOOMQYIRITHL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |