C6H6N2O3 — CID 11788405
1-acetyl-5-methylideneimidazolidine-2,4-dione (PubChem CID 11788405) has the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. Its IUPAC name is 1-acetyl-5-methylideneimidazolidine-2,4-dione.
| Compound Name | 1-acetyl-5-methylideneimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11788405 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 1-acetyl-5-methylideneimidazolidine-2,4-dione |
| SMILES | C=C1C(=O)NC(=O)N1C(C)=O |
| InChI | InChI=1S/C6H6N2O3/c1-3-5(10)7-6(11)8(3)4(2)9/h1H2,2H3,(H,7,10,11) |
| InChIKey | FSSOJKWGBBFRIE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|