About 2-ethylheptane-1,3-diol
2-ethylheptane-1,3-diol (PubChem CID 11788460) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 2-ethylheptane-1,3-diol.
Molecular Properties
| Compound Name | 2-ethylheptane-1,3-diol |
| PubChem CID | 11788460 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 2-ethylheptane-1,3-diol |
| SMILES | CCCCC(O)C(CC)CO |
| InChI | InChI=1S/C9H20O2/c1-3-5-6-9(11)8(4-2)7-10/h8-11H,3-7H2,1-2H3 |
| InChIKey | BPOSPHPRYDVTFU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylheptane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylheptane-1,3-diol?
The IUPAC name of 2-ethylheptane-1,3-diol (CID 11788460) is 2-ethylheptane-1,3-diol.
What is the SMILES notation for 2-ethylheptane-1,3-diol?
The canonical SMILES for 2-ethylheptane-1,3-diol is CCCCC(O)C(CC)CO.
What is the InChIKey of 2-ethylheptane-1,3-diol?
The InChIKey is BPOSPHPRYDVTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-3-5-6-9(11)8(4-2)7-10/h8-11H,3-7H2,1-2H3.
What are the key properties of 2-ethylheptane-1,3-diol?
2-ethylheptane-1,3-diol has a molecular weight of 160.26 g/mol, XLogP of 1.56, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylheptane-1,3-diol is sourced from PubChem (CID 11788460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).