About 2-N,2-N-diethylpyridine-2,5-diamine
2-N,2-N-diethylpyridine-2,5-diamine (PubChem CID 11788486) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-N,2-N-diethylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-diethylpyridine-2,5-diamine |
| PubChem CID | 11788486 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-N,2-N-diethylpyridine-2,5-diamine |
| SMILES | CCN(CC)c1ccc(N)cn1 |
| InChI | InChI=1S/C9H15N3/c1-3-12(4-2)9-6-5-8(10)7-11-9/h5-7H,3-4,10H2,1-2H3 |
| InChIKey | OBNDQWYYQMAJDN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,2-N-diethylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-diethylpyridine-2,5-diamine?
The IUPAC name of 2-N,2-N-diethylpyridine-2,5-diamine (CID 11788486) is 2-N,2-N-diethylpyridine-2,5-diamine.
What is the SMILES notation for 2-N,2-N-diethylpyridine-2,5-diamine?
The canonical SMILES for 2-N,2-N-diethylpyridine-2,5-diamine is CCN(CC)c1ccc(N)cn1.
What is the InChIKey of 2-N,2-N-diethylpyridine-2,5-diamine?
The InChIKey is OBNDQWYYQMAJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-3-12(4-2)9-6-5-8(10)7-11-9/h5-7H,3-4,10H2,1-2H3.
What are the key properties of 2-N,2-N-diethylpyridine-2,5-diamine?
2-N,2-N-diethylpyridine-2,5-diamine has a molecular weight of 165.24 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-diethylpyridine-2,5-diamine is sourced from PubChem (CID 11788486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).