About (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine
(3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine (PubChem CID 11788638) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine.
Molecular Properties
| Compound Name | (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine |
| PubChem CID | 11788638 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine |
| SMILES | N[C@@H]1COc2ccccc2SC1 |
| InChI | InChI=1S/C9H11NOS/c10-7-5-11-8-3-1-2-4-9(8)12-6-7/h1-4,7H,5-6,10H2/t7-/m1/s1 |
| InChIKey | SRFRZISOGOOCHA-SSDOTTSWSA-N |
| XLogP | 1.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine?
The IUPAC name of (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine (CID 11788638) is (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine.
What is the SMILES notation for (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine?
The canonical SMILES for (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine is N[C@@H]1COc2ccccc2SC1.
What is the InChIKey of (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine?
The InChIKey is SRFRZISOGOOCHA-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H11NOS/c10-7-5-11-8-3-1-2-4-9(8)12-6-7/h1-4,7H,5-6,10H2/t7-/m1/s1.
What are the key properties of (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine?
(3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine has a molecular weight of 181.26 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine is sourced from PubChem (CID 11788638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).