About S-(4-chlorophenyl) ethanethioate
S-(4-chlorophenyl) ethanethioate (PubChem CID 11788703) has the molecular formula C8H7ClOS
and a molecular weight of 186.66 g/mol. Its IUPAC name is S-(4-chlorophenyl) ethanethioate.
Molecular Properties
| Compound Name | S-(4-chlorophenyl) ethanethioate |
| PubChem CID | 11788703 |
| Molecular Formula | C8H7ClOS |
| Molecular Weight | 186.66 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | S-(4-chlorophenyl) ethanethioate |
| SMILES | CC(=O)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7ClOS/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3 |
| InChIKey | QERKIPHHPNUKGG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-chlorophenyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-chlorophenyl) ethanethioate?
The IUPAC name of S-(4-chlorophenyl) ethanethioate (CID 11788703) is S-(4-chlorophenyl) ethanethioate.
What is the SMILES notation for S-(4-chlorophenyl) ethanethioate?
The canonical SMILES for S-(4-chlorophenyl) ethanethioate is CC(=O)Sc1ccc(Cl)cc1.
What is the InChIKey of S-(4-chlorophenyl) ethanethioate?
The InChIKey is QERKIPHHPNUKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClOS/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3.
What are the key properties of S-(4-chlorophenyl) ethanethioate?
S-(4-chlorophenyl) ethanethioate has a molecular weight of 186.66 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-chlorophenyl) ethanethioate is sourced from PubChem (CID 11788703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).