About 1-diazoethylbenzene
1-diazoethylbenzene (PubChem CID 11789245) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 1-diazoethylbenzene.
Molecular Properties
| Compound Name | 1-diazoethylbenzene |
| PubChem CID | 11789245 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1-diazoethylbenzene |
| SMILES | CC(=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C8H8N2/c1-7(10-9)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | ZJUUFFQSHKFHKD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazoethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazoethylbenzene?
The IUPAC name of 1-diazoethylbenzene (CID 11789245) is 1-diazoethylbenzene.
What is the SMILES notation for 1-diazoethylbenzene?
The canonical SMILES for 1-diazoethylbenzene is CC(=[N+]=[N-])c1ccccc1.
What is the InChIKey of 1-diazoethylbenzene?
The InChIKey is ZJUUFFQSHKFHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-7(10-9)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 1-diazoethylbenzene?
1-diazoethylbenzene has a molecular weight of 132.17 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazoethylbenzene is sourced from PubChem (CID 11789245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).