About 3-phenyloxetane
3-phenyloxetane (PubChem CID 11789254) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3-phenyloxetane.
Molecular Properties
| Compound Name | 3-phenyloxetane |
| PubChem CID | 11789254 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 3-phenyloxetane |
| SMILES | c1ccc(C2COC2)cc1 |
| InChI | InChI=1S/C9H10O/c1-2-4-8(5-3-1)9-6-10-7-9/h1-5,9H,6-7H2 |
| InChIKey | ROAGGVYFIYBKOY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyloxetane?
The IUPAC name of 3-phenyloxetane (CID 11789254) is 3-phenyloxetane.
What is the SMILES notation for 3-phenyloxetane?
The canonical SMILES for 3-phenyloxetane is c1ccc(C2COC2)cc1.
What is the InChIKey of 3-phenyloxetane?
The InChIKey is ROAGGVYFIYBKOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-2-4-8(5-3-1)9-6-10-7-9/h1-5,9H,6-7H2.
What are the key properties of 3-phenyloxetane?
3-phenyloxetane has a molecular weight of 134.18 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyloxetane is sourced from PubChem (CID 11789254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).