About Borane N,N-diisopropylethylamine complex
Borane N,N-diisopropylethylamine complex (PubChem CID 11789314) has the molecular formula C8H19BN
and a molecular weight of 140.06 g/mol.
Molecular Properties
| Compound Name | Borane N,N-diisopropylethylamine complex |
| PubChem CID | 11789314 |
| Molecular Formula | C8H19BN |
| Molecular Weight | 140.06 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | — |
| SMILES | CCN(C(C)C)C(C)C.[B] |
| InChI | InChI=1S/C8H19N.B/c1-6-9(7(2)3)8(4)5;/h7-8H,6H2,1-5H3; |
| InChIKey | BYKCUMSOQIPHSR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.06 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Borane N,N-diisopropylethylamine complex with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Borane N,N-diisopropylethylamine complex?
The IUPAC name of Borane N,N-diisopropylethylamine complex (CID 11789314) is not available.
What is the SMILES notation for Borane N,N-diisopropylethylamine complex?
The canonical SMILES for Borane N,N-diisopropylethylamine complex is CCN(C(C)C)C(C)C.[B].
What is the InChIKey of Borane N,N-diisopropylethylamine complex?
The InChIKey is BYKCUMSOQIPHSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.B/c1-6-9(7(2)3)8(4)5;/h7-8H,6H2,1-5H3;.
What are the key properties of Borane N,N-diisopropylethylamine complex?
Borane N,N-diisopropylethylamine complex has a molecular weight of 140.06 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Borane N,N-diisopropylethylamine complex is sourced from PubChem (CID 11789314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).