About (3R)-3,7-dimethyloct-6-enenitrile
(3R)-3,7-dimethyloct-6-enenitrile (PubChem CID 11789380) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is (3R)-3,7-dimethyloct-6-enenitrile.
Molecular Properties
| Compound Name | (3R)-3,7-dimethyloct-6-enenitrile |
| PubChem CID | 11789380 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3R)-3,7-dimethyloct-6-enenitrile |
| SMILES | CC(C)=CCC[C@@H](C)CC#N |
| InChI | InChI=1S/C10H17N/c1-9(2)5-4-6-10(3)7-8-11/h5,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | MTDAKBBUYMYKAR-SNVBAGLBSA-N |
| XLogP | 3.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,7-dimethyloct-6-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,7-dimethyloct-6-enenitrile?
The IUPAC name of (3R)-3,7-dimethyloct-6-enenitrile (CID 11789380) is (3R)-3,7-dimethyloct-6-enenitrile.
What is the SMILES notation for (3R)-3,7-dimethyloct-6-enenitrile?
The canonical SMILES for (3R)-3,7-dimethyloct-6-enenitrile is CC(C)=CCC[C@@H](C)CC#N.
What is the InChIKey of (3R)-3,7-dimethyloct-6-enenitrile?
The InChIKey is MTDAKBBUYMYKAR-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H17N/c1-9(2)5-4-6-10(3)7-8-11/h5,10H,4,6-7H2,1-3H3/t10-/m1/s1.
What are the key properties of (3R)-3,7-dimethyloct-6-enenitrile?
(3R)-3,7-dimethyloct-6-enenitrile has a molecular weight of 151.25 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,7-dimethyloct-6-enenitrile is sourced from PubChem (CID 11789380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).