About 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione
5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione (PubChem CID 11789385) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione.
Molecular Properties
| Compound Name | 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione |
| PubChem CID | 11789385 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1=C(C)C(O)=CC(=O)C1=O |
| InChI | InChI=1S/C8H8O3/c1-4-5(2)8(11)7(10)3-6(4)9/h3,9H,1-2H3 |
| InChIKey | CLIPUZJCIHXURB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione?
The IUPAC name of 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione (CID 11789385) is 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione.
What is the SMILES notation for 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione?
The canonical SMILES for 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione is CC1=C(C)C(O)=CC(=O)C1=O.
What is the InChIKey of 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione?
The InChIKey is CLIPUZJCIHXURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-4-5(2)8(11)7(10)3-6(4)9/h3,9H,1-2H3.
What are the key properties of 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione?
5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione has a molecular weight of 152.15 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,4-dimethylcyclohexa-3,5-diene-1,2-dione is sourced from PubChem (CID 11789385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).