About 1-phenylpent-1-yn-3-ol
1-phenylpent-1-yn-3-ol (PubChem CID 11789508) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-phenylpent-1-yn-3-ol.
Molecular Properties
| Compound Name | 1-phenylpent-1-yn-3-ol |
| PubChem CID | 11789508 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 1-phenylpent-1-yn-3-ol |
| SMILES | CCC(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C11H12O/c1-2-11(12)9-8-10-6-4-3-5-7-10/h3-7,11-12H,2H2,1H3 |
| InChIKey | QWCMSASONHVIHV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpent-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpent-1-yn-3-ol?
The IUPAC name of 1-phenylpent-1-yn-3-ol (CID 11789508) is 1-phenylpent-1-yn-3-ol.
What is the SMILES notation for 1-phenylpent-1-yn-3-ol?
The canonical SMILES for 1-phenylpent-1-yn-3-ol is CCC(O)C#Cc1ccccc1.
What is the InChIKey of 1-phenylpent-1-yn-3-ol?
The InChIKey is QWCMSASONHVIHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-2-11(12)9-8-10-6-4-3-5-7-10/h3-7,11-12H,2H2,1H3.
What are the key properties of 1-phenylpent-1-yn-3-ol?
1-phenylpent-1-yn-3-ol has a molecular weight of 160.22 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpent-1-yn-3-ol is sourced from PubChem (CID 11789508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).