About 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone
1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone (PubChem CID 11789521) has the molecular formula C5H7NOS2
and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone |
| PubChem CID | 11789521 |
| Molecular Formula | C5H7NOS2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone |
| SMILES | CC(=O)N1CCSC1=S |
| InChI | InChI=1S/C5H7NOS2/c1-4(7)6-2-3-9-5(6)8/h2-3H2,1H3 |
| InChIKey | BMOBFBQWISCVKX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone?
The IUPAC name of 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone (CID 11789521) is 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone.
What is the SMILES notation for 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone?
The canonical SMILES for 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone is CC(=O)N1CCSC1=S.
What is the InChIKey of 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone?
The InChIKey is BMOBFBQWISCVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS2/c1-4(7)6-2-3-9-5(6)8/h2-3H2,1H3.
What are the key properties of 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone?
1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone has a molecular weight of 161.25 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone is sourced from PubChem (CID 11789521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).