C8H13NO3 — CID 11789658
(4aR,5S)-5-methoxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 11789658) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (4aR,5S)-5-methoxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4aR,5S)-5-methoxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 11789658 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (4aR,5S)-5-methoxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
| SMILES | CO[C@H]1CCN2C(=O)OCC[C@H]12 |
| InChI | InChI=1S/C8H13NO3/c1-11-7-2-4-9-6(7)3-5-12-8(9)10/h6-7H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | SSZWDWKBQDTYCS-RQJHMYQMSA-N |
| XLogP | 0.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |