C10H12O3 — CID 11789806
(4E,8Z)-2-methyl-3,6-dihydro-2H-oxecine-7,10-dione (PubChem CID 11789806) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (4E,8Z)-2-methyl-3,6-dihydro-2H-oxecine-7,10-dione.
| Compound Name | (4E,8Z)-2-methyl-3,6-dihydro-2H-oxecine-7,10-dione |
|---|---|
| PubChem CID | 11789806 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (4E,8Z)-2-methyl-3,6-dihydro-2H-oxecine-7,10-dione |
| SMILES | CC1C/C=C/CC(=O)/C=C\C(=O)O1 |
| InChI | InChI=1S/C10H12O3/c1-8-4-2-3-5-9(11)6-7-10(12)13-8/h2-3,6-8H,4-5H2,1H3/b3-2+,7-6- |
| InChIKey | WCUIQFQLYQAXHU-OBJMPXFKSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|