About 2-isocyanato-4,6-dimethoxypyrimidine
2-isocyanato-4,6-dimethoxypyrimidine (PubChem CID 11789825) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-isocyanato-4,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 2-isocyanato-4,6-dimethoxypyrimidine |
| PubChem CID | 11789825 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2-isocyanato-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(N=C=O)n1 |
| InChI | InChI=1S/C7H7N3O3/c1-12-5-3-6(13-2)10-7(9-5)8-4-11/h3H,1-2H3 |
| InChIKey | HIRYVXKOUYSVQJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-4,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-4,6-dimethoxypyrimidine?
The IUPAC name of 2-isocyanato-4,6-dimethoxypyrimidine (CID 11789825) is 2-isocyanato-4,6-dimethoxypyrimidine.
What is the SMILES notation for 2-isocyanato-4,6-dimethoxypyrimidine?
The canonical SMILES for 2-isocyanato-4,6-dimethoxypyrimidine is COc1cc(OC)nc(N=C=O)n1.
What is the InChIKey of 2-isocyanato-4,6-dimethoxypyrimidine?
The InChIKey is HIRYVXKOUYSVQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c1-12-5-3-6(13-2)10-7(9-5)8-4-11/h3H,1-2H3.
What are the key properties of 2-isocyanato-4,6-dimethoxypyrimidine?
2-isocyanato-4,6-dimethoxypyrimidine has a molecular weight of 181.15 g/mol, XLogP of 0.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-4,6-dimethoxypyrimidine is sourced from PubChem (CID 11789825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).