C4H2N6O3 — CID 11789870
3-nitro-6H-(215N)[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-one (PubChem CID 11789870) has the molecular formula C4H2N6O3 and a molecular weight of 183.09 g/mol. Its IUPAC name is 3-nitro-6H-(215N)[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-one.
| Compound Name | 3-nitro-6H-(215N)[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 11789870 |
| Molecular Formula | C4H2N6O3 |
| Molecular Weight | 183.09 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 3-nitro-6H-(215N)[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-one |
| SMILES | O=c1c([N+](=O)[O-])nnc2nc[15nH]n12 |
| InChI | InChI=1S/C4H2N6O3/c11-3-2(10(12)13)7-8-4-5-1-6-9(3)4/h1H,(H,5,6,8)/i6+1 |
| InChIKey | PJWJEUJIMJNSEA-PTQBSOBMSA-N |
| XLogP | -1.28 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.09 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|