About (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile
(2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile (PubChem CID 11789994) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile |
| PubChem CID | 11789994 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)CCC/C1=C/CCCO |
| InChI | InChI=1S/C11H14N2O/c12-8-11(9-13)6-3-5-10(11)4-1-2-7-14/h4,14H,1-3,5-7H2/b10-4- |
| InChIKey | YHDQXHODAPVFGI-WMZJFQQLSA-N |
| XLogP | 1.90 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile?
The IUPAC name of (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile (CID 11789994) is (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile.
What is the SMILES notation for (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile?
The canonical SMILES for (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile is N#CC1(C#N)CCC/C1=C/CCCO.
What is the InChIKey of (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile?
The InChIKey is YHDQXHODAPVFGI-WMZJFQQLSA-N. The full InChI is InChI=1S/C11H14N2O/c12-8-11(9-13)6-3-5-10(11)4-1-2-7-14/h4,14H,1-3,5-7H2/b10-4-.
What are the key properties of (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile?
(2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile has a molecular weight of 190.25 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(4-hydroxybutylidene)cyclopentane-1,1-dicarbonitrile is sourced from PubChem (CID 11789994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).