C12H18O2 — CID 11790088
(1S,4S,5R)-4-(1-hydroxyethyl)-2,2-dimethylbicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11790088) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,4S,5R)-4-(1-hydroxyethyl)-2,2-dimethylbicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,4S,5R)-4-(1-hydroxyethyl)-2,2-dimethylbicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11790088 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,4S,5R)-4-(1-hydroxyethyl)-2,2-dimethylbicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC(O)[C@H]1C(=O)C(C)(C)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H18O2/c1-7(13)10-8-4-5-9(6-8)12(2,3)11(10)14/h4-5,7-10,13H,6H2,1-3H3/t7?,8-,9+,10+/m0/s1 |
| InChIKey | UMQGXIZEWJQKEC-HCZOVWHVSA-N |
| XLogP | 1.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|