C10H16O4 — CID 11790205
(1R,2R,4S,5S,6R,7S)-6,7-bis(methoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octane (PubChem CID 11790205) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (1R,2R,4S,5S,6R,7S)-6,7-bis(methoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octane.
| Compound Name | (1R,2R,4S,5S,6R,7S)-6,7-bis(methoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 11790205 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (1R,2R,4S,5S,6R,7S)-6,7-bis(methoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octane |
| SMILES | COC[C@@H]1[C@H](COC)[C@@H]2O[C@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C10H16O4/c1-11-3-5-6(4-12-2)8-10-9(14-10)7(5)13-8/h5-10H,3-4H2,1-2H3/t5-,6+,7-,8+,9-,10+ |
| InChIKey | KPBNGWNKNFNDRO-VNQPEFDQSA-N |
| XLogP | 0.06 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|