About N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide
N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 11790283) has the molecular formula C5H8F3NO2S
and a molecular weight of 203.18 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 11790283 |
| Molecular Formula | C5H8F3NO2S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCC1CC1)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2S/c6-5(7,8)12(10,11)9-3-4-1-2-4/h4,9H,1-3H2 |
| InChIKey | FNXLAVQIVKAGAT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide (CID 11790283) is N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide is O=S(=O)(NCC1CC1)C(F)(F)F.
What is the InChIKey of N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide?
The InChIKey is FNXLAVQIVKAGAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO2S/c6-5(7,8)12(10,11)9-3-4-1-2-4/h4,9H,1-3H2.
What are the key properties of N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide?
N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide has a molecular weight of 203.18 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 11790283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).