About 4-fluorobenzenediazonium tetrafluoroborate
4-fluorobenzenediazonium tetrafluoroborate (PubChem CID 11790468) has the molecular formula C6H4BF5N2
and a molecular weight of 209.91 g/mol. Its IUPAC name is 4-fluorobenzenediazonium tetrafluoroborate.
Molecular Properties
| Compound Name | 4-fluorobenzenediazonium tetrafluoroborate |
| PubChem CID | 11790468 |
| Molecular Formula | C6H4BF5N2 |
| Molecular Weight | 209.91 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4-fluorobenzenediazonium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[N+]c1ccc(F)cc1 |
| InChI | InChI=1S/C6H4FN2.BF4/c7-5-1-3-6(9-8)4-2-5;2-1(3,4)5/h1-4H;/q+1;-1 |
| InChIKey | FMZSAFIGGZOVJQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzenediazonium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzenediazonium tetrafluoroborate?
The IUPAC name of 4-fluorobenzenediazonium tetrafluoroborate (CID 11790468) is 4-fluorobenzenediazonium tetrafluoroborate.
What is the SMILES notation for 4-fluorobenzenediazonium tetrafluoroborate?
The canonical SMILES for 4-fluorobenzenediazonium tetrafluoroborate is F[B-](F)(F)F.N#[N+]c1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzenediazonium tetrafluoroborate?
The InChIKey is FMZSAFIGGZOVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FN2.BF4/c7-5-1-3-6(9-8)4-2-5;2-1(3,4)5/h1-4H;/q+1;-1.
What are the key properties of 4-fluorobenzenediazonium tetrafluoroborate?
4-fluorobenzenediazonium tetrafluoroborate has a molecular weight of 209.91 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzenediazonium tetrafluoroborate is sourced from PubChem (CID 11790468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).