C6H4F3NO4 — CID 11790496
N-[(3R)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 11790496) has the molecular formula C6H4F3NO4 and a molecular weight of 211.09 g/mol. Its IUPAC name is N-[(3R)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3R)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11790496 |
| Molecular Formula | C6H4F3NO4 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | N-[(3R)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1C[C@@H](NC(=O)C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C6H4F3NO4/c7-6(8,9)5(13)10-2-1-3(11)14-4(2)12/h2H,1H2,(H,10,13)/t2-/m1/s1 |
| InChIKey | ABTJOHYOWBAGTP-UWTATZPHSA-N |
| XLogP | -0.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|