C12H16O4 — CID 11790833
(3R,4S)-3,4-dihydroxy-5-phenylmethoxypentan-2-one (PubChem CID 11790833) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3R,4S)-3,4-dihydroxy-5-phenylmethoxypentan-2-one.
| Compound Name | (3R,4S)-3,4-dihydroxy-5-phenylmethoxypentan-2-one |
|---|---|
| PubChem CID | 11790833 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3R,4S)-3,4-dihydroxy-5-phenylmethoxypentan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C12H16O4/c1-9(13)12(15)11(14)8-16-7-10-5-3-2-4-6-10/h2-6,11-12,14-15H,7-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | RWZATQKQMVVYJV-RYUDHWBXSA-N |
| XLogP | 0.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |