About trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane
trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane (PubChem CID 11790857) has the molecular formula C13H24OSi
and a molecular weight of 224.42 g/mol. Its IUPAC name is trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane.
Molecular Properties
| Compound Name | trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane |
| PubChem CID | 11790857 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane |
| SMILES | C[Si](C)(C)OC12CCCCC3CC3C1C2 |
| InChI | InChI=1S/C13H24OSi/c1-15(2,3)14-13-7-5-4-6-10-8-11(10)12(13)9-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | XJBFACPNKDZAID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane?
The IUPAC name of trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane (CID 11790857) is trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane.
What is the SMILES notation for trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane?
The canonical SMILES for trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane is C[Si](C)(C)OC12CCCCC3CC3C1C2.
What is the InChIKey of trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane?
The InChIKey is XJBFACPNKDZAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24OSi/c1-15(2,3)14-13-7-5-4-6-10-8-11(10)12(13)9-13/h10-12H,4-9H2,1-3H3.
What are the key properties of trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane?
trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane has a molecular weight of 224.42 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(4-tricyclo[7.1.0.02,4]decanyloxy)silane is sourced from PubChem (CID 11790857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).