C13H22O3 — CID 11790905
(2S,6S)-5-methylidene-2,6-bis(2-methylpropyl)-1,3-dioxan-4-one (PubChem CID 11790905) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S,6S)-5-methylidene-2,6-bis(2-methylpropyl)-1,3-dioxan-4-one.
| Compound Name | (2S,6S)-5-methylidene-2,6-bis(2-methylpropyl)-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 11790905 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2S,6S)-5-methylidene-2,6-bis(2-methylpropyl)-1,3-dioxan-4-one |
| SMILES | C=C1C(=O)O[C@@H](CC(C)C)O[C@H]1CC(C)C |
| InChI | InChI=1S/C13H22O3/c1-8(2)6-11-10(5)13(14)16-12(15-11)7-9(3)4/h8-9,11-12H,5-7H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | SMPMVEZJUZPTAZ-RYUDHWBXSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|