About 4-Mercapto-1-octanol
4-Mercapto-1-octanol (PubChem CID 117910869) has the molecular formula C8H18OS
and a molecular weight of 162.30 g/mol. Its IUPAC name is 4-sulfanyloctan-1-ol.
Molecular Properties
| Compound Name | 4-Mercapto-1-octanol |
| PubChem CID | 117910869 |
| Molecular Formula | C8H18OS |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 4-sulfanyloctan-1-ol |
| SMILES | CCCCC(CCCO)S |
| InChI | InChI=1S/C8H18OS/c1-2-3-5-8(10)6-4-7-9/h8-10H,2-7H2,1H3 |
| InChIKey | JANHCJQUCRCVOO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | 66 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-Mercapto-1-octanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Mercapto-1-octanol?
The IUPAC name of 4-Mercapto-1-octanol (CID 117910869) is 4-sulfanyloctan-1-ol.
What is the SMILES notation for 4-Mercapto-1-octanol?
The canonical SMILES for 4-Mercapto-1-octanol is CCCCC(CCCO)S.
What is the InChIKey of 4-Mercapto-1-octanol?
The InChIKey is JANHCJQUCRCVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18OS/c1-2-3-5-8(10)6-4-7-9/h8-10H,2-7H2,1H3.
What are the key properties of 4-Mercapto-1-octanol?
4-Mercapto-1-octanol has a molecular weight of 162.30 g/mol, XLogP of 2.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Mercapto-1-octanol is sourced from PubChem (CID 117910869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).