C15H22O2 — CID 11791138
(1S,2R,6R,9R)-2,6-dimethyl-10-methylidene-12-oxatricyclo[7.3.1.01,6]tridecan-11-one (PubChem CID 11791138) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1S,2R,6R,9R)-2,6-dimethyl-10-methylidene-12-oxatricyclo[7.3.1.01,6]tridecan-11-one.
| Compound Name | (1S,2R,6R,9R)-2,6-dimethyl-10-methylidene-12-oxatricyclo[7.3.1.01,6]tridecan-11-one |
|---|---|
| PubChem CID | 11791138 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1S,2R,6R,9R)-2,6-dimethyl-10-methylidene-12-oxatricyclo[7.3.1.01,6]tridecan-11-one |
| SMILES | C=C1C(=O)O[C@]23C[C@H]1CC[C@@]2(C)CCC[C@H]3C |
| InChI | InChI=1S/C15H22O2/c1-10-5-4-7-14(3)8-6-12-9-15(10,14)17-13(16)11(12)2/h10,12H,2,4-9H2,1,3H3/t10-,12-,14-,15+/m1/s1 |
| InChIKey | PIJHVHSSMSPXBS-LTZCYQRMSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|