About methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate
methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate (PubChem CID 11791154) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate |
| PubChem CID | 11791154 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1NC(=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H13NO4/c1-16-10(14)7-9-11(17-12(15)13-9)8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3,(H,13,15)/t9-,11+/m0/s1 |
| InChIKey | CWALJBZQGFTBBD-GXSJLCMTSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate?
The IUPAC name of methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate (CID 11791154) is methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate.
What is the SMILES notation for methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate?
The canonical SMILES for methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate is COC(=O)C[C@@H]1NC(=O)O[C@@H]1c1ccccc1.
What is the InChIKey of methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate?
The InChIKey is CWALJBZQGFTBBD-GXSJLCMTSA-N. The full InChI is InChI=1S/C12H13NO4/c1-16-10(14)7-9-11(17-12(15)13-9)8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3,(H,13,15)/t9-,11+/m0/s1.
What are the key properties of methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate?
methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate has a molecular weight of 235.24 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4S,5R)-2-oxo-5-phenyl-1,3-oxazolidin-4-yl]acetate is sourced from PubChem (CID 11791154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).