C12H12O5 — CID 11791176
(4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarbaldehyde (PubChem CID 11791176) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is (4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarbaldehyde.
| Compound Name | (4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarbaldehyde |
|---|---|
| PubChem CID | 11791176 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarbaldehyde |
| SMILES | COc1ccc(C2O[C@@H](C=O)[C@H](C=O)O2)cc1 |
| InChI | InChI=1S/C12H12O5/c1-15-9-4-2-8(3-5-9)12-16-10(6-13)11(7-14)17-12/h2-7,10-12H,1H3/t10-,11-/m0/s1 |
| InChIKey | KVRGWTBYBAJMKS-QWRGUYRKSA-N |
| XLogP | 0.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|