C11H10O4S — CID 11791241
(1S,5R)-1-(benzenesulfonyl)-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 11791241) has the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. Its IUPAC name is (1S,5R)-1-(benzenesulfonyl)-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R)-1-(benzenesulfonyl)-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 11791241 |
| Molecular Formula | C11H10O4S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (1S,5R)-1-(benzenesulfonyl)-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1OC[C@H]2C[C@@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O4S/c12-10-11(6-8(11)7-15-10)16(13,14)9-4-2-1-3-5-9/h1-5,8H,6-7H2/t8-,11+/m1/s1 |
| InChIKey | GECNRSTUNRQQBC-KCJUWKMLSA-N |
| XLogP | 0.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |