C12H17NO4 — CID 11791272
(1R,2R,6R,7Z)-4,4-dimethyl-3,5,13-trioxa-11-azatricyclo[9.3.0.02,6]tetradec-7-en-12-one (PubChem CID 11791272) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (1R,2R,6R,7Z)-4,4-dimethyl-3,5,13-trioxa-11-azatricyclo[9.3.0.02,6]tetradec-7-en-12-one.
| Compound Name | (1R,2R,6R,7Z)-4,4-dimethyl-3,5,13-trioxa-11-azatricyclo[9.3.0.02,6]tetradec-7-en-12-one |
|---|---|
| PubChem CID | 11791272 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (1R,2R,6R,7Z)-4,4-dimethyl-3,5,13-trioxa-11-azatricyclo[9.3.0.02,6]tetradec-7-en-12-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3COC(=O)N3CC/C=C\[C@H]2O1 |
| InChI | InChI=1S/C12H17NO4/c1-12(2)16-9-5-3-4-6-13-8(10(9)17-12)7-15-11(13)14/h3,5,8-10H,4,6-7H2,1-2H3/b5-3-/t8-,9-,10-/m1/s1 |
| InChIKey | ZWEGWPQLKIASDV-GCSAUYLNSA-N |
| XLogP | 1.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|