C15H28O2 — CID 11791321
(3Z,6Z)-1,1-di(propan-2-yloxy)nona-3,6-diene (PubChem CID 11791321) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3Z,6Z)-1,1-di(propan-2-yloxy)nona-3,6-diene.
| Compound Name | (3Z,6Z)-1,1-di(propan-2-yloxy)nona-3,6-diene |
|---|---|
| PubChem CID | 11791321 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3Z,6Z)-1,1-di(propan-2-yloxy)nona-3,6-diene |
| SMILES | CC/C=C\C/C=C\CC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C15H28O2/c1-6-7-8-9-10-11-12-15(16-13(2)3)17-14(4)5/h7-8,10-11,13-15H,6,9,12H2,1-5H3/b8-7-,11-10- |
| InChIKey | LDIAMRWFQHNYJZ-NQLNTKRDSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|