About 1-bromo-2,4-dichloro-5-fluorobenzene
1-bromo-2,4-dichloro-5-fluorobenzene (PubChem CID 11791393) has the molecular formula C6H2BrCl2F
and a molecular weight of 243.89 g/mol. Its IUPAC name is 1-bromo-2,4-dichloro-5-fluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-2,4-dichloro-5-fluorobenzene |
|---|
| PubChem CID | 11791393 |
|---|
| Molecular Formula | C6H2BrCl2F |
|---|
| Molecular Weight | 243.89 g/mol |
|---|
| Exact Mass | 241.87 |
|---|
| IUPAC Name | 1-bromo-2,4-dichloro-5-fluorobenzene |
|---|
| SMILES | Fc1cc(Br)c(Cl)cc1Cl |
|---|
| InChI | InChI=1S/C6H2BrCl2F/c7-3-1-6(10)5(9)2-4(3)8/h1-2H |
|---|
| InChIKey | HNCWLJLWAVCZDM-UHFFFAOYSA-N |
|---|
| XLogP | 3.89 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 243.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,4-dichloro-5-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,4-dichloro-5-fluorobenzene?
The IUPAC name of 1-bromo-2,4-dichloro-5-fluorobenzene (CID 11791393) is 1-bromo-2,4-dichloro-5-fluorobenzene.
What is the SMILES notation for 1-bromo-2,4-dichloro-5-fluorobenzene?
The canonical SMILES for 1-bromo-2,4-dichloro-5-fluorobenzene is Fc1cc(Br)c(Cl)cc1Cl.
What is the InChIKey of 1-bromo-2,4-dichloro-5-fluorobenzene?
The InChIKey is HNCWLJLWAVCZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrCl2F/c7-3-1-6(10)5(9)2-4(3)8/h1-2H.
What are the key properties of 1-bromo-2,4-dichloro-5-fluorobenzene?
1-bromo-2,4-dichloro-5-fluorobenzene has a molecular weight of 243.89 g/mol, XLogP of 3.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,4-dichloro-5-fluorobenzene is sourced from PubChem (CID 11791393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).