methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate

C14H15NO3 — CID 11791437

IUPACmethyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate
SMILESCOC(=O)N1CC(=O)C=CC1Cc1ccccc1
InChIInChI=1S/C14H15NO3/c1-18-14(17)15-10-13(16)8-7-12(15)9-11-5-3-2-4-6-11/h2-8,12H,9-10H2,1H3
InChIKeyCRWYJZNUMLGUIE-UHFFFAOYSA-N
MW245.28 g/mol
LogP1.80
Rot. Bonds2

About methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate

methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate (PubChem CID 11791437) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate
PubChem CID11791437
Molecular FormulaC14H15NO3
Molecular Weight245.28 g/mol
Exact Mass245.11
IUPAC Namemethyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate
SMILESCOC(=O)N1CC(=O)C=CC1Cc1ccccc1
InChIInChI=1S/C14H15NO3/c1-18-14(17)15-10-13(16)8-7-12(15)9-11-5-3-2-4-6-11/h2-8,12H,9-10H2,1H3
InChIKeyCRWYJZNUMLGUIE-UHFFFAOYSA-N
XLogP1.80
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 51.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate?
The IUPAC name of methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate (CID 11791437) is methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate.
What is the SMILES notation for methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate?
The canonical SMILES for methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate is COC(=O)N1CC(=O)C=CC1Cc1ccccc1.
What is the InChIKey of methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate?
The InChIKey is CRWYJZNUMLGUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-18-14(17)15-10-13(16)8-7-12(15)9-11-5-3-2-4-6-11/h2-8,12H,9-10H2,1H3.
What are the key properties of methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate?
methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate has a molecular weight of 245.28 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzyl-5-oxo-2,6-dihydropyridine-1-carboxylate is sourced from PubChem (CID 11791437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).