About 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene
2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene (PubChem CID 11791526) has the molecular formula C11H21O4P
and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene.
Molecular Properties
| Compound Name | 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene |
| PubChem CID | 11791526 |
| Molecular Formula | C11H21O4P |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene |
| SMILES | CCOP(=O)(OCC)C(=C=C(C)C)COC |
| InChI | InChI=1S/C11H21O4P/c1-6-14-16(12,15-7-2)11(9-13-5)8-10(3)4/h6-7,9H2,1-5H3 |
| InChIKey | LYHCNYCGVRTPST-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene?
The IUPAC name of 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene (CID 11791526) is 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene.
What is the SMILES notation for 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene?
The canonical SMILES for 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene is CCOP(=O)(OCC)C(=C=C(C)C)COC.
What is the InChIKey of 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene?
The InChIKey is LYHCNYCGVRTPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21O4P/c1-6-14-16(12,15-7-2)11(9-13-5)8-10(3)4/h6-7,9H2,1-5H3.
What are the key properties of 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene?
2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene has a molecular weight of 248.26 g/mol, XLogP of 3.35, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphoryl-1-methoxy-4-methylpenta-2,3-diene is sourced from PubChem (CID 11791526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).