C22H32O3 — CID 11791748
[(4bS,8aS,9S)-3-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] acetate (PubChem CID 11791748) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(4bS,8aS,9S)-3-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] acetate.
| Compound Name | [(4bS,8aS,9S)-3-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 11791748 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(4bS,8aS,9S)-3-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1Cc2cc(C(C)C)c(O)cc2[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C22H32O3/c1-13(2)16-10-15-11-19(25-14(3)23)20-21(4,5)8-7-9-22(20,6)17(15)12-18(16)24/h10,12-13,19-20,24H,7-9,11H2,1-6H3/t19-,20-,22+/m0/s1 |
| InChIKey | DKFWEVHDRVCABW-JAXLGGSGSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |