C18H14Cl2N2O — CID 11791778
1,6-dibenzyl-3,5-dichloropyrazin-2-one (PubChem CID 11791778) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is 1,6-dibenzyl-3,5-dichloropyrazin-2-one.
| Compound Name | 1,6-dibenzyl-3,5-dichloropyrazin-2-one |
|---|---|
| PubChem CID | 11791778 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 1,6-dibenzyl-3,5-dichloropyrazin-2-one |
| SMILES | O=c1c(Cl)nc(Cl)c(Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H14Cl2N2O/c19-16-15(11-13-7-3-1-4-8-13)22(18(23)17(20)21-16)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | JXNGIFGKQSAOSK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |