C19H20ClNO3 — CID 11791826
2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylethanol (PubChem CID 11791826) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylethanol.
| Compound Name | 2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 11791826 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-chloro-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1-phenylethanol |
| SMILES | COC[C@@H]1N=C(C(Cl)C(O)c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20ClNO3/c1-23-12-15-18(14-10-6-3-7-11-14)24-19(21-15)16(20)17(22)13-8-4-2-5-9-13/h2-11,15-18,22H,12H2,1H3/t15-,16?,17?,18-/m0/s1 |
| InChIKey | XLGIMJIZOBAOKF-BFWZDYSYSA-N |
| XLogP | 3.51 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|